C26H26ClF2N5O2S — CID 143478241
carbamoyl 1,3-thiazole-4-carboximidate;3-[1-[1-[(4-chlorophenyl)methyl]azetidin-3-yl]-2-fluoro-2-methylpropyl]-5-fluorobenzonitrile (PubChem CID 143478241) has the molecular formula C26H26ClF2N5O2S and a molecular weight of 546.04 g/mol. Its IUPAC name is carbamoyl 1,3-thiazole-4-carboximidate;3-[1-[1-[(4-chlorophenyl)methyl]azetidin-3-yl]-2-fluoro-2-methylpropyl]-5-fluorobenzonitrile.
| Compound Name | carbamoyl 1,3-thiazole-4-carboximidate;3-[1-[1-[(4-chlorophenyl)methyl]azetidin-3-yl]-2-fluoro-2-methylpropyl]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 143478241 |
| Molecular Formula | C26H26ClF2N5O2S |
| Molecular Weight | 546.04 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | carbamoyl 1,3-thiazole-4-carboximidate;3-[1-[1-[(4-chlorophenyl)methyl]azetidin-3-yl]-2-fluoro-2-methylpropyl]-5-fluorobenzonitrile |
| SMILES | CC(C)(F)C(c1cc(F)cc(C#N)c1)C1CN(Cc2ccc(Cl)cc2)C1.[H]/N=C(\OC(N)=O)c1cscn1 |
| InChI | InChI=1S/C21H21ClF2N2.C5H5N3O2S/c1-21(2,24)20(16-7-15(10-25)8-19(23)9-16)17-12-26(13-17)11-14-3-5-18(22)6-4-14;6-4(10-5(7)9)3-1-11-2-8-3/h3-9,17,20H,11-13H2,1-2H3;1-2,6H,(H2,7,9)/b;6-4- |
| InChIKey | ZBRTZZLBVNVSKZ-QQLTZMNSSA-N |
| XLogP | 5.88 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.04 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|