C18H18F3N3OS — CID 134077489
1,3-thiazol-4-yl-[2-[[4-(trifluoromethyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 134077489) has the molecular formula C18H18F3N3OS and a molecular weight of 381.42 g/mol. Its IUPAC name is 1,3-thiazol-4-yl-[2-[[4-(trifluoromethyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | 1,3-thiazol-4-yl-[2-[[4-(trifluoromethyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 134077489 |
| Molecular Formula | C18H18F3N3OS |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 1,3-thiazol-4-yl-[2-[[4-(trifluoromethyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | O=C(c1cscn1)N1CC2CN(Cc3ccc(C(F)(F)F)cc3)CC2C1 |
| InChI | InChI=1S/C18H18F3N3OS/c19-18(20,21)15-3-1-12(2-4-15)5-23-6-13-8-24(9-14(13)7-23)17(25)16-10-26-11-22-16/h1-4,10-11,13-14H,5-9H2 |
| InChIKey | DHAFMNILRAYDLN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |