C24H27ClFN3O4 — CID 143479175
(2R,3R)-4-[2-(3-chlorocyclohexyl)pyrrolidin-1-yl]-N-[3-(3-cyano-4-fluorophenyl)prop-2-ynyl]-2,3-dihydroxy-4-oxobutanamide (PubChem CID 143479175) has the molecular formula C24H27ClFN3O4 and a molecular weight of 475.95 g/mol. Its IUPAC name is (2R,3R)-4-[2-(3-chlorocyclohexyl)pyrrolidin-1-yl]-N-[3-(3-cyano-4-fluorophenyl)prop-2-ynyl]-2,3-dihydroxy-4-oxobutanamide.
| Compound Name | (2R,3R)-4-[2-(3-chlorocyclohexyl)pyrrolidin-1-yl]-N-[3-(3-cyano-4-fluorophenyl)prop-2-ynyl]-2,3-dihydroxy-4-oxobutanamide |
|---|---|
| PubChem CID | 143479175 |
| Molecular Formula | C24H27ClFN3O4 |
| Molecular Weight | 475.95 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | (2R,3R)-4-[2-(3-chlorocyclohexyl)pyrrolidin-1-yl]-N-[3-(3-cyano-4-fluorophenyl)prop-2-ynyl]-2,3-dihydroxy-4-oxobutanamide |
| SMILES | N#Cc1cc(C#CCNC(=O)[C@H](O)[C@@H](O)C(=O)N2CCCC2C2CCCC(Cl)C2)ccc1F |
| InChI | InChI=1S/C24H27ClFN3O4/c25-18-6-1-5-16(13-18)20-7-3-11-29(20)24(33)22(31)21(30)23(32)28-10-2-4-15-8-9-19(26)17(12-15)14-27/h8-9,12,16,18,20-22,30-31H,1,3,5-7,10-11,13H2,(H,28,32)/t16?,18?,20?,21-,22-/m1/s1 |
| InChIKey | FPBDXTLCVWVLMS-HCPCXLKESA-N |
| XLogP | 1.68 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.95 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|