C27H33N3O5 — CID 143479220
(2R,3R)-N-[(1S)-1-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]ethyl]-4-[(3E,4Z)-4-ethylidene-3-prop-2-enylidenepiperidin-1-yl]-2,3-dihydroxy-4-oxobutanamide (PubChem CID 143479220) has the molecular formula C27H33N3O5 and a molecular weight of 479.58 g/mol. Its IUPAC name is (2R,3R)-N-[(1S)-1-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]ethyl]-4-[(3E,4Z)-4-ethylidene-3-prop-2-enylidenepiperidin-1-yl]-2,3-dihydroxy-4-oxobutanamide.
| Compound Name | (2R,3R)-N-[(1S)-1-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]ethyl]-4-[(3E,4Z)-4-ethylidene-3-prop-2-enylidenepiperidin-1-yl]-2,3-dihydroxy-4-oxobutanamide |
|---|---|
| PubChem CID | 143479220 |
| Molecular Formula | C27H33N3O5 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | (2R,3R)-N-[(1S)-1-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]ethyl]-4-[(3E,4Z)-4-ethylidene-3-prop-2-enylidenepiperidin-1-yl]-2,3-dihydroxy-4-oxobutanamide |
| SMILES | C=C/C=C1/CN(C(=O)[C@H](O)[C@@H](O)C(=O)N[C@@H](C)c2ccc(-c3c(C)noc3C)cc2)CC/C1=C/C |
| InChI | InChI=1S/C27H33N3O5/c1-6-8-22-15-30(14-13-19(22)7-2)27(34)25(32)24(31)26(33)28-16(3)20-9-11-21(12-10-20)23-17(4)29-35-18(23)5/h6-12,16,24-25,31-32H,1,13-15H2,2-5H3,(H,28,33)/b19-7-,22-8-/t16-,24+,25+/m0/s1 |
| InChIKey | KNZSBHZXMIVUTE-YPBJWQGWSA-N |
| XLogP | 3.15 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |