C15H12FN3O3 — CID 143480079
ethyl 5-cyano-4-(3-fluoro-4-formamidophenyl)-1H-pyrrole-3-carboxylate (PubChem CID 143480079) has the molecular formula C15H12FN3O3 and a molecular weight of 301.28 g/mol. Its IUPAC name is ethyl 5-cyano-4-(3-fluoro-4-formamidophenyl)-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-cyano-4-(3-fluoro-4-formamidophenyl)-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 143480079 |
| Molecular Formula | C15H12FN3O3 |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | ethyl 5-cyano-4-(3-fluoro-4-formamidophenyl)-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c(C#N)c1-c1ccc(NC=O)c(F)c1 |
| InChI | InChI=1S/C15H12FN3O3/c1-2-22-15(21)10-7-18-13(6-17)14(10)9-3-4-12(19-8-20)11(16)5-9/h3-5,7-8,18H,2H2,1H3,(H,19,20) |
| InChIKey | RSCAGOCLDIXAIE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|