C19H29NO4 — CID 14348478
methyl 2-(1-hydroxyethyl)-4-methyl-5-phenylmethoxy-3-(prop-2-enylamino)pentanoate (PubChem CID 14348478) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is methyl 2-(1-hydroxyethyl)-4-methyl-5-phenylmethoxy-3-(prop-2-enylamino)pentanoate.
| Compound Name | methyl 2-(1-hydroxyethyl)-4-methyl-5-phenylmethoxy-3-(prop-2-enylamino)pentanoate |
|---|---|
| PubChem CID | 14348478 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | methyl 2-(1-hydroxyethyl)-4-methyl-5-phenylmethoxy-3-(prop-2-enylamino)pentanoate |
| SMILES | C=CCNC(C(C)COCc1ccccc1)C(C(=O)OC)C(C)O |
| InChI | InChI=1S/C19H29NO4/c1-5-11-20-18(17(15(3)21)19(22)23-4)14(2)12-24-13-16-9-7-6-8-10-16/h5-10,14-15,17-18,20-21H,1,11-13H2,2-4H3 |
| InChIKey | SEIHMEAWZGSWBI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|