C19H14Cl3N3O2S — CID 143484859
methyl 3-[[5-chloro-3-[(3,4-dichlorophenyl)sulfanylamino]-2-pyridinyl]oxy]benzenecarboximidate (PubChem CID 143484859) has the molecular formula C19H14Cl3N3O2S and a molecular weight of 454.77 g/mol. Its IUPAC name is methyl 3-[[5-chloro-3-[(3,4-dichlorophenyl)sulfanylamino]-2-pyridinyl]oxy]benzenecarboximidate.
| Compound Name | methyl 3-[[5-chloro-3-[(3,4-dichlorophenyl)sulfanylamino]-2-pyridinyl]oxy]benzenecarboximidate |
|---|---|
| PubChem CID | 143484859 |
| Molecular Formula | C19H14Cl3N3O2S |
| Molecular Weight | 454.77 g/mol |
| Exact Mass | 452.99 |
| IUPAC Name | methyl 3-[[5-chloro-3-[(3,4-dichlorophenyl)sulfanylamino]-2-pyridinyl]oxy]benzenecarboximidate |
| SMILES | [H]/N=C(\OC)c1cccc(Oc2ncc(Cl)cc2NSc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C19H14Cl3N3O2S/c1-26-18(23)11-3-2-4-13(7-11)27-19-17(8-12(20)10-24-19)25-28-14-5-6-15(21)16(22)9-14/h2-10,23,25H,1H3/b23-18- |
| InChIKey | ZHQYGJRZDPMHKC-NKFKGCMQSA-N |
| XLogP | 6.93 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.77 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|