C25H22ClF2N3O2S — CID 167495843
N-[3-[[3-[[4-chloro-3-(1,1-difluoroethyl)phenyl]sulfanylamino]-5-methyl-2-pyridinyl]oxy]phenyl]-N-methylbut-2-ynamide (PubChem CID 167495843) has the molecular formula C25H22ClF2N3O2S and a molecular weight of 501.99 g/mol. Its IUPAC name is N-[3-[[3-[[4-chloro-3-(1,1-difluoroethyl)phenyl]sulfanylamino]-5-methyl-2-pyridinyl]oxy]phenyl]-N-methylbut-2-ynamide.
| Compound Name | N-[3-[[3-[[4-chloro-3-(1,1-difluoroethyl)phenyl]sulfanylamino]-5-methyl-2-pyridinyl]oxy]phenyl]-N-methylbut-2-ynamide |
|---|---|
| PubChem CID | 167495843 |
| Molecular Formula | C25H22ClF2N3O2S |
| Molecular Weight | 501.99 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | N-[3-[[3-[[4-chloro-3-(1,1-difluoroethyl)phenyl]sulfanylamino]-5-methyl-2-pyridinyl]oxy]phenyl]-N-methylbut-2-ynamide |
| SMILES | CC#CC(=O)N(C)c1cccc(Oc2ncc(C)cc2NSc2ccc(Cl)c(C(C)(F)F)c2)c1 |
| InChI | InChI=1S/C25H22ClF2N3O2S/c1-5-7-23(32)31(4)17-8-6-9-18(13-17)33-24-22(12-16(2)15-29-24)30-34-19-10-11-21(26)20(14-19)25(3,27)28/h6,8-15,30H,1-4H3 |
| InChIKey | NMQASNAAZZYRCD-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.99 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|