C19H12ClF3N6OS — CID 143745115
[3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfanylamino]-5-methyl-2-pyridinyl]-(7H-purin-6-yl)methanone (PubChem CID 143745115) has the molecular formula C19H12ClF3N6OS and a molecular weight of 464.86 g/mol. Its IUPAC name is [3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfanylamino]-5-methyl-2-pyridinyl]-(7H-purin-6-yl)methanone.
| Compound Name | [3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfanylamino]-5-methyl-2-pyridinyl]-(7H-purin-6-yl)methanone |
|---|---|
| PubChem CID | 143745115 |
| Molecular Formula | C19H12ClF3N6OS |
| Molecular Weight | 464.86 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | [3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfanylamino]-5-methyl-2-pyridinyl]-(7H-purin-6-yl)methanone |
| SMILES | Cc1cnc(C(=O)c2ncnc3nc[nH]c23)c(NSc2ccc(Cl)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C19H12ClF3N6OS/c1-9-4-13(29-31-10-2-3-12(20)11(5-10)19(21,22)23)14(24-6-9)17(30)15-16-18(27-7-25-15)28-8-26-16/h2-8,29H,1H3,(H,25,26,27,28) |
| InChIKey | RMTLWOJJTRIPAQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.86 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|