C18H16Cl2F3N3OS — CID 143610582
[5-chloro-3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfanylamino]-2-pyridinyl]-piperidin-1-ylmethanone (PubChem CID 143610582) has the molecular formula C18H16Cl2F3N3OS and a molecular weight of 450.31 g/mol. Its IUPAC name is [5-chloro-3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfanylamino]-2-pyridinyl]-piperidin-1-ylmethanone.
| Compound Name | [5-chloro-3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfanylamino]-2-pyridinyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 143610582 |
| Molecular Formula | C18H16Cl2F3N3OS |
| Molecular Weight | 450.31 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | [5-chloro-3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfanylamino]-2-pyridinyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1ncc(Cl)cc1NSc1ccc(Cl)c(C(F)(F)F)c1)N1CCCCC1 |
| InChI | InChI=1S/C18H16Cl2F3N3OS/c19-11-8-15(16(24-10-11)17(27)26-6-2-1-3-7-26)25-28-12-4-5-14(20)13(9-12)18(21,22)23/h4-5,8-10,25H,1-3,6-7H2 |
| InChIKey | ZVDFSTRMSNXUIH-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.31 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|