C21H11Cl3F3N3OS — CID 143610429
8-chloro-4-[4-chloro-2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfanylamino]phenyl]-2H-phthalazin-1-one (PubChem CID 143610429) has the molecular formula C21H11Cl3F3N3OS and a molecular weight of 516.76 g/mol. Its IUPAC name is 8-chloro-4-[4-chloro-2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfanylamino]phenyl]-2H-phthalazin-1-one.
| Compound Name | 8-chloro-4-[4-chloro-2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfanylamino]phenyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 143610429 |
| Molecular Formula | C21H11Cl3F3N3OS |
| Molecular Weight | 516.76 g/mol |
| Exact Mass | 514.96 |
| IUPAC Name | 8-chloro-4-[4-chloro-2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfanylamino]phenyl]-2H-phthalazin-1-one |
| SMILES | O=c1[nH]nc(-c2ccc(Cl)cc2NSc2ccc(Cl)c(C(F)(F)F)c2)c2cccc(Cl)c12 |
| InChI | InChI=1S/C21H11Cl3F3N3OS/c22-10-4-6-12(19-13-2-1-3-16(24)18(13)20(31)29-28-19)17(8-10)30-32-11-5-7-15(23)14(9-11)21(25,26)27/h1-9,30H,(H,29,31) |
| InChIKey | PXLPMWVROIOWPI-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.76 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|