C30H33NO — CID 143485632
(E)-3,4-bis(ethenyl)-2-methyl-7-[3-[(E)-2-(7-methylquinolin-2-yl)ethenyl]phenyl]hept-3-en-2-ol (PubChem CID 143485632) has the molecular formula C30H33NO and a molecular weight of 423.60 g/mol. Its IUPAC name is (E)-3,4-bis(ethenyl)-2-methyl-7-[3-[(E)-2-(7-methylquinolin-2-yl)ethenyl]phenyl]hept-3-en-2-ol.
| Compound Name | (E)-3,4-bis(ethenyl)-2-methyl-7-[3-[(E)-2-(7-methylquinolin-2-yl)ethenyl]phenyl]hept-3-en-2-ol |
|---|---|
| PubChem CID | 143485632 |
| Molecular Formula | C30H33NO |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | (E)-3,4-bis(ethenyl)-2-methyl-7-[3-[(E)-2-(7-methylquinolin-2-yl)ethenyl]phenyl]hept-3-en-2-ol |
| SMILES | C=C/C(CCCc1cccc(/C=C/c2ccc3ccc(C)cc3n2)c1)=C(\C=C)C(C)(C)O |
| InChI | InChI=1S/C30H33NO/c1-6-25(28(7-2)30(4,5)32)13-9-12-23-10-8-11-24(21-23)15-18-27-19-17-26-16-14-22(3)20-29(26)31-27/h6-8,10-11,14-21,32H,1-2,9,12-13H2,3-5H3/b18-15+,28-25- |
| InChIKey | FTZWOXCXIGUPLB-GYPSLGRWSA-N |
| XLogP | 7.48 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|