C57H45N5 — CID 143485846
N-[(4-carbazol-9-ylcyclohexa-2,4-dien-1-yl)methylidene]-N'-[(4-carbazol-9-ylphenyl)methyl]-4-[3-methyl-2-[(Z)-prop-1-enyl]indol-1-yl]benzenecarboximidamide (PubChem CID 143485846) has the molecular formula C57H45N5 and a molecular weight of 800.02 g/mol. Its IUPAC name is N-[(4-carbazol-9-ylcyclohexa-2,4-dien-1-yl)methylidene]-N'-[(4-carbazol-9-ylphenyl)methyl]-4-[3-methyl-2-[(Z)-prop-1-enyl]indol-1-yl]benzenecarboximidamide.
| Compound Name | N-[(4-carbazol-9-ylcyclohexa-2,4-dien-1-yl)methylidene]-N'-[(4-carbazol-9-ylphenyl)methyl]-4-[3-methyl-2-[(Z)-prop-1-enyl]indol-1-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 143485846 |
| Molecular Formula | C57H45N5 |
| Molecular Weight | 800.02 g/mol |
| Exact Mass | 799.37 |
| IUPAC Name | N-[(4-carbazol-9-ylcyclohexa-2,4-dien-1-yl)methylidene]-N'-[(4-carbazol-9-ylphenyl)methyl]-4-[3-methyl-2-[(Z)-prop-1-enyl]indol-1-yl]benzenecarboximidamide |
| SMILES | C/C=C\c1c(C)c2ccccc2n1-c1ccc(C(/N=C/C2C=CC(n3c4ccccc4c4ccccc43)=CC2)=N\Cc2ccc(-n3c4ccccc4c4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C57H45N5/c1-3-14-51-39(2)46-15-4-9-20-52(46)60(51)45-35-29-42(30-36-45)57(58-37-40-25-31-43(32-26-40)61-53-21-10-5-16-47(53)48-17-6-11-22-54(48)61)59-38-41-27-33-44(34-28-41)62-55-23-12-7-18-49(55)50-19-8-13-24-56(50)62/h3-27,29-36,38,41H,28,37H2,1-2H3/b14-3-,58-57+,59-38+ |
| InChIKey | SBXAOZBEBJWKLX-SJGMHPBQSA-N |
| XLogP | 14.31 |
| TPSA | 39.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.02 |
| LogP ≤ 5 | 14.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|