C40H35N3 — CID 142925758
(Z)-3-benzylimino-3-[4-[4-[2-methyl-3-[(Z)-prop-1-enyl]indol-1-yl]phenyl]phenyl]-1-phenylprop-1-en-1-amine (PubChem CID 142925758) has the molecular formula C40H35N3 and a molecular weight of 557.74 g/mol. Its IUPAC name is (Z)-3-benzylimino-3-[4-[4-[2-methyl-3-[(Z)-prop-1-enyl]indol-1-yl]phenyl]phenyl]-1-phenylprop-1-en-1-amine.
| Compound Name | (Z)-3-benzylimino-3-[4-[4-[2-methyl-3-[(Z)-prop-1-enyl]indol-1-yl]phenyl]phenyl]-1-phenylprop-1-en-1-amine |
|---|---|
| PubChem CID | 142925758 |
| Molecular Formula | C40H35N3 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | (Z)-3-benzylimino-3-[4-[4-[2-methyl-3-[(Z)-prop-1-enyl]indol-1-yl]phenyl]phenyl]-1-phenylprop-1-en-1-amine |
| SMILES | C/C=C\c1c(C)n(-c2ccc(-c3ccc(C(/C=C(\N)c4ccccc4)=N\Cc4ccccc4)cc3)cc2)c2ccccc12 |
| InChI | InChI=1S/C40H35N3/c1-3-12-36-29(2)43(40-18-11-10-17-37(36)40)35-25-23-32(24-26-35)31-19-21-34(22-20-31)39(42-28-30-13-6-4-7-14-30)27-38(41)33-15-8-5-9-16-33/h3-27H,28,41H2,1-2H3/b12-3-,38-27-,42-39- |
| InChIKey | OJUNHJQWGJZAIT-YHUMKNOGSA-N |
| XLogP | 9.63 |
| TPSA | 43.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|