C55H60N2 — CID 144775544
N'-benzyl-3-[6,7-dimethyl-5,8-bis[(Z)-prop-1-enyl]naphthalen-2-yl]-5-[4-[(3E)-hepta-1,3-dien-3-yl]phenyl]benzenecarboximidamide;ethene;ethylbenzene (PubChem CID 144775544) has the molecular formula C55H60N2 and a molecular weight of 749.10 g/mol. Its IUPAC name is N'-benzyl-3-[6,7-dimethyl-5,8-bis[(Z)-prop-1-enyl]naphthalen-2-yl]-5-[4-[(3E)-hepta-1,3-dien-3-yl]phenyl]benzenecarboximidamide;ethene;ethylbenzene.
| Compound Name | N'-benzyl-3-[6,7-dimethyl-5,8-bis[(Z)-prop-1-enyl]naphthalen-2-yl]-5-[4-[(3E)-hepta-1,3-dien-3-yl]phenyl]benzenecarboximidamide;ethene;ethylbenzene |
|---|---|
| PubChem CID | 144775544 |
| Molecular Formula | C55H60N2 |
| Molecular Weight | 749.10 g/mol |
| Exact Mass | 748.48 |
| IUPAC Name | N'-benzyl-3-[6,7-dimethyl-5,8-bis[(Z)-prop-1-enyl]naphthalen-2-yl]-5-[4-[(3E)-hepta-1,3-dien-3-yl]phenyl]benzenecarboximidamide;ethene;ethylbenzene |
| SMILES | C=C.C=C/C(=C\CCC)c1ccc(-c2cc(/C(N)=N/Cc3ccccc3)cc(-c3ccc4c(/C=C\C)c(C)c(C)c(/C=C\C)c4c3)c2)cc1.CCc1ccccc1 |
| InChI | InChI=1S/C45H46N2.C8H10.C2H4/c1-7-11-19-34(10-4)35-20-22-36(23-21-35)38-26-39(28-40(27-38)45(46)47-30-33-17-13-12-14-18-33)37-24-25-43-41(15-8-2)31(5)32(6)42(16-9-3)44(43)29-37;1-2-8-6-4-3-5-7-8;1-2/h8-10,12-29H,4,7,11,30H2,1-3,5-6H3,(H2,46,47);3-7H,2H2,1H3;1-2H2/b15-8-,16-9-,34-19+;; |
| InChIKey | VWVCXZBHLXFSFS-XGYOSJBTSA-N |
| XLogP | 15.18 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.10 |
| LogP ≤ 5 | 15.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|