C9H13FO2S — CID 143486671
(3Z,5E)-2-fluoro-5-methyl-6-methylsulfonylhepta-1,3,5-triene (PubChem CID 143486671) has the molecular formula C9H13FO2S and a molecular weight of 204.27 g/mol. Its IUPAC name is (3Z,5E)-2-fluoro-5-methyl-6-methylsulfonylhepta-1,3,5-triene.
| Compound Name | (3Z,5E)-2-fluoro-5-methyl-6-methylsulfonylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 143486671 |
| Molecular Formula | C9H13FO2S |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | (3Z,5E)-2-fluoro-5-methyl-6-methylsulfonylhepta-1,3,5-triene |
| SMILES | C=C(F)/C=C\C(C)=C(/C)S(C)(=O)=O |
| InChI | InChI=1S/C9H13FO2S/c1-7(5-6-8(2)10)9(3)13(4,11)12/h5-6H,2H2,1,3-4H3/b6-5-,9-7+ |
| InChIKey | NNTGPTAOIHYKSE-BZWSEGBZSA-N |
| XLogP | 2.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|