C28H35N3O3 — CID 143486880
tert-butyl 4-[(3Z,5E)-5-(5-cyano-7-methyl-1,3-benzoxazol-2-yl)hepta-1,3,5-trien-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate;ethane (PubChem CID 143486880) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is tert-butyl 4-[(3Z,5E)-5-(5-cyano-7-methyl-1,3-benzoxazol-2-yl)hepta-1,3,5-trien-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-[(3Z,5E)-5-(5-cyano-7-methyl-1,3-benzoxazol-2-yl)hepta-1,3,5-trien-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 143486880 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | tert-butyl 4-[(3Z,5E)-5-(5-cyano-7-methyl-1,3-benzoxazol-2-yl)hepta-1,3,5-trien-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate;ethane |
| SMILES | C=C(/C=C\C(=C/C)c1nc2cc(C#N)cc(C)c2o1)C1=CCN(C(=O)OC(C)(C)C)CC1.CC |
| InChI | InChI=1S/C26H29N3O3.C2H6/c1-7-20(24-28-22-15-19(16-27)14-18(3)23(22)31-24)9-8-17(2)21-10-12-29(13-11-21)25(30)32-26(4,5)6;1-2/h7-10,14-15H,2,11-13H2,1,3-6H3;1-2H3/b9-8-,20-7+; |
| InChIKey | BQFAQUTYZRZPRR-NERXCERZSA-N |
| XLogP | 7.12 |
| TPSA | 79.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|