C9H18N2 — CID 143487946
(E)-N,N-dimethyl-5-methyliminohex-3-en-3-amine (PubChem CID 143487946) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is (E)-N,N-dimethyl-5-methyliminohex-3-en-3-amine.
| Compound Name | (E)-N,N-dimethyl-5-methyliminohex-3-en-3-amine |
|---|---|
| PubChem CID | 143487946 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (E)-N,N-dimethyl-5-methyliminohex-3-en-3-amine |
| SMILES | CC/C(=C\C(C)=N\C)N(C)C |
| InChI | InChI=1S/C9H18N2/c1-6-9(11(4)5)7-8(2)10-3/h7H,6H2,1-5H3/b9-7+,10-8+ |
| InChIKey | SYSSGTYOCJKJOS-FIFLTTCUSA-N |
| XLogP | 1.93 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|