C15H29F2N2+ — CID 156677182
[(Z)-1,7-difluoro-5-[methyl(propyl)amino]hept-4-en-3-ylidene]-methyl-propylazanium (PubChem CID 156677182) has the molecular formula C15H29F2N2+ and a molecular weight of 275.41 g/mol. Its IUPAC name is [(Z)-1,7-difluoro-5-[methyl(propyl)amino]hept-4-en-3-ylidene]-methyl-propylazanium.
| Compound Name | [(Z)-1,7-difluoro-5-[methyl(propyl)amino]hept-4-en-3-ylidene]-methyl-propylazanium |
|---|---|
| PubChem CID | 156677182 |
| Molecular Formula | C15H29F2N2+ |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.23 |
| IUPAC Name | [(Z)-1,7-difluoro-5-[methyl(propyl)amino]hept-4-en-3-ylidene]-methyl-propylazanium |
| SMILES | CCCN(C)/C(=C\C(CCF)=[N+](/C)CCC)CCF |
| InChI | InChI=1S/C15H29F2N2/c1-5-11-18(3)14(7-9-16)13-15(8-10-17)19(4)12-6-2/h13H,5-12H2,1-4H3/q+1 |
| InChIKey | ZXVABWXUESBFDK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|