C15H31AlN2 — CID 154587304
(Z)-N-butan-2-yl-5-butan-2-ylimino-N-dideuterioalumanylhept-3-en-3-amine (PubChem CID 154587304) has the molecular formula C15H31AlN2 and a molecular weight of 268.42 g/mol. Its IUPAC name is (Z)-N-butan-2-yl-5-butan-2-ylimino-N-dideuterioalumanylhept-3-en-3-amine.
| Compound Name | (Z)-N-butan-2-yl-5-butan-2-ylimino-N-dideuterioalumanylhept-3-en-3-amine |
|---|---|
| PubChem CID | 154587304 |
| Molecular Formula | C15H31AlN2 |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | (Z)-N-butan-2-yl-5-butan-2-ylimino-N-dideuterioalumanylhept-3-en-3-amine |
| SMILES | [2H][Al]([2H])N(/C(=C\C(CC)=N\C(C)CC)CC)C(C)CC |
| InChI | InChI=1S/C15H29N2.Al.2H/c1-7-12(5)16-14(9-3)11-15(10-4)17-13(6)8-2;;;/h11-13H,7-10H2,1-6H3;;;/q-1;+1;;/b14-11-,17-15+;;;/i;;2*1+1 |
| InChIKey | PMKNUJIKJNDEQV-MUUQVYOPSA-N |
| XLogP | 3.58 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|