C13H26AlClN2 — CID 154587310
(Z)-N-[chloro(deuterio)alumanyl]-N-propan-2-yl-5-propan-2-yliminohept-3-en-3-amine (PubChem CID 154587310) has the molecular formula C13H26AlClN2 and a molecular weight of 273.81 g/mol. Its IUPAC name is (Z)-N-[chloro(deuterio)alumanyl]-N-propan-2-yl-5-propan-2-yliminohept-3-en-3-amine.
| Compound Name | (Z)-N-[chloro(deuterio)alumanyl]-N-propan-2-yl-5-propan-2-yliminohept-3-en-3-amine |
|---|---|
| PubChem CID | 154587310 |
| Molecular Formula | C13H26AlClN2 |
| Molecular Weight | 273.81 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (Z)-N-[chloro(deuterio)alumanyl]-N-propan-2-yl-5-propan-2-yliminohept-3-en-3-amine |
| SMILES | [2H][Al](Cl)N(/C(=C\C(CC)=N\C(C)C)CC)C(C)C |
| InChI | InChI=1S/C13H25N2.Al.ClH.H/c1-7-12(14-10(3)4)9-13(8-2)15-11(5)6;;;/h9-11H,7-8H2,1-6H3;;1H;/q-1;+2;;/p-1/b12-9-,15-13+;;;/i;;;1+1 |
| InChIKey | AYQBDWXYFBXVOJ-LSPQNZMDSA-M |
| XLogP | 3.76 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.81 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|