C12H24AlClN2 — CID 154587313
(Z)-N-[chloro(propan-2-yl)alumanyl]-N-methyl-5-methyliminohept-3-en-3-amine (PubChem CID 154587313) has the molecular formula C12H24AlClN2 and a molecular weight of 258.77 g/mol. Its IUPAC name is (Z)-N-[chloro(propan-2-yl)alumanyl]-N-methyl-5-methyliminohept-3-en-3-amine.
| Compound Name | (Z)-N-[chloro(propan-2-yl)alumanyl]-N-methyl-5-methyliminohept-3-en-3-amine |
|---|---|
| PubChem CID | 154587313 |
| Molecular Formula | C12H24AlClN2 |
| Molecular Weight | 258.77 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (Z)-N-[chloro(propan-2-yl)alumanyl]-N-methyl-5-methyliminohept-3-en-3-amine |
| SMILES | CC/C(=C/C(CC)=N/C)N(C)[Al](Cl)C(C)C |
| InChI | InChI=1S/C9H17N2.C3H7.Al.ClH/c1-5-8(10-3)7-9(6-2)11-4;1-3-2;;/h7H,5-6H2,1-4H3;3H,1-2H3;;1H/q-1;;+2;/p-1/b8-7-,11-9+;;; |
| InChIKey | CEIRGZVAOSRYDM-IDVPCYQJSA-M |
| XLogP | 3.83 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.77 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|