C15H31AlN2 — CID 153097017
(Z)-N-diethylalumanyl-N-ethyl-5-ethyliminohept-3-en-3-amine (PubChem CID 153097017) has the molecular formula C15H31AlN2 and a molecular weight of 266.41 g/mol. Its IUPAC name is (Z)-N-diethylalumanyl-N-ethyl-5-ethyliminohept-3-en-3-amine.
| Compound Name | (Z)-N-diethylalumanyl-N-ethyl-5-ethyliminohept-3-en-3-amine |
|---|---|
| PubChem CID | 153097017 |
| Molecular Formula | C15H31AlN2 |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.23 |
| IUPAC Name | (Z)-N-diethylalumanyl-N-ethyl-5-ethyliminohept-3-en-3-amine |
| SMILES | CC/N=C(/C=C(/CC)N(CC)[Al](CC)CC)CC |
| InChI | InChI=1S/C11H21N2.2C2H5.Al/c1-5-10(12-7-3)9-11(6-2)13-8-4;2*1-2;/h9H,5-8H2,1-4H3;2*1H2,2H3;/q-1;;;+1/b10-9-,13-11+;;; |
| InChIKey | VQHXHNKHWCVUKD-PKMVWEJNSA-N |
| XLogP | 4.50 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|