C13H27AlN2 — CID 147679532
(Z)-N-diethylalumanyl-N-methyl-5-methyliminohept-3-en-3-amine (PubChem CID 147679532) has the molecular formula C13H27AlN2 and a molecular weight of 238.35 g/mol. Its IUPAC name is (Z)-N-diethylalumanyl-N-methyl-5-methyliminohept-3-en-3-amine.
| Compound Name | (Z)-N-diethylalumanyl-N-methyl-5-methyliminohept-3-en-3-amine |
|---|---|
| PubChem CID | 147679532 |
| Molecular Formula | C13H27AlN2 |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | (Z)-N-diethylalumanyl-N-methyl-5-methyliminohept-3-en-3-amine |
| SMILES | CC/C(=C/C(CC)=N/C)N(C)[Al](CC)CC |
| InChI | InChI=1S/C9H17N2.2C2H5.Al/c1-5-8(10-3)7-9(6-2)11-4;2*1-2;/h7H,5-6H2,1-4H3;2*1H2,2H3;/q-1;;;+1/b8-7-,11-9+;;; |
| InChIKey | GOVLAWGEWUZTFV-IDVPCYQJSA-N |
| XLogP | 3.72 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|