C11H23AlN2 — CID 154587331
(Z)-N-dideuterioalumanyl-N-ethyl-5-ethyliminohept-3-en-3-amine (PubChem CID 154587331) has the molecular formula C11H23AlN2 and a molecular weight of 212.31 g/mol. Its IUPAC name is (Z)-N-dideuterioalumanyl-N-ethyl-5-ethyliminohept-3-en-3-amine.
| Compound Name | (Z)-N-dideuterioalumanyl-N-ethyl-5-ethyliminohept-3-en-3-amine |
|---|---|
| PubChem CID | 154587331 |
| Molecular Formula | C11H23AlN2 |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (Z)-N-dideuterioalumanyl-N-ethyl-5-ethyliminohept-3-en-3-amine |
| SMILES | [2H][Al]([2H])N(CC)/C(=C\C(CC)=N\CC)CC |
| InChI | InChI=1S/C11H21N2.Al.2H/c1-5-10(12-7-3)9-11(6-2)13-8-4;;;/h9H,5-8H2,1-4H3;;;/q-1;+1;;/b10-9-,13-11+;;;/i;;2*1+1 |
| InChIKey | MSVXUYALVSPSHH-OOIBXHHDSA-N |
| XLogP | 2.02 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|