C20H22ClN5O — CID 143488222
5-(4-chlorophenyl)-13-(dimethylamino)-8-methyl-3,5,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one;ethane (PubChem CID 143488222) has the molecular formula C20H22ClN5O and a molecular weight of 383.88 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-13-(dimethylamino)-8-methyl-3,5,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one;ethane.
| Compound Name | 5-(4-chlorophenyl)-13-(dimethylamino)-8-methyl-3,5,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one;ethane |
|---|---|
| PubChem CID | 143488222 |
| Molecular Formula | C20H22ClN5O |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 5-(4-chlorophenyl)-13-(dimethylamino)-8-methyl-3,5,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one;ethane |
| SMILES | CC.CN(C)c1ccnc2c1c1ncn(-c3ccc(Cl)cc3)c(=O)c1n2C |
| InChI | InChI=1S/C18H16ClN5O.C2H6/c1-22(2)13-8-9-20-17-14(13)15-16(23(17)3)18(25)24(10-21-15)12-6-4-11(19)5-7-12;1-2/h4-10H,1-3H3;1-2H3 |
| InChIKey | XLFSBEQQLDZLBU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |