C18H18ClN5O — CID 89048640
5-(4-chlorocyclohexa-1,5-dien-1-yl)-13-(dimethylamino)-8-methyl-3,5,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one (PubChem CID 89048640) has the molecular formula C18H18ClN5O and a molecular weight of 355.83 g/mol. Its IUPAC name is 5-(4-chlorocyclohexa-1,5-dien-1-yl)-13-(dimethylamino)-8-methyl-3,5,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one.
| Compound Name | 5-(4-chlorocyclohexa-1,5-dien-1-yl)-13-(dimethylamino)-8-methyl-3,5,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
|---|---|
| PubChem CID | 89048640 |
| Molecular Formula | C18H18ClN5O |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 5-(4-chlorocyclohexa-1,5-dien-1-yl)-13-(dimethylamino)-8-methyl-3,5,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| SMILES | CN(C)c1ccnc2c1c1ncn(C3=CCC(Cl)C=C3)c(=O)c1n2C |
| InChI | InChI=1S/C18H18ClN5O/c1-22(2)13-8-9-20-17-14(13)15-16(23(17)3)18(25)24(10-21-15)12-6-4-11(19)5-7-12/h4,6-11H,5H2,1-3H3 |
| InChIKey | VMVHFXFBUWUTIY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|