C16H20FN3 — CID 143488771
(E,5E)-N-ethenyl-5-(4-fluorophenyl)-5-(prop-2-enylhydrazinylidene)pent-2-en-2-amine (PubChem CID 143488771) has the molecular formula C16H20FN3 and a molecular weight of 273.36 g/mol. Its IUPAC name is (E,5E)-N-ethenyl-5-(4-fluorophenyl)-5-(prop-2-enylhydrazinylidene)pent-2-en-2-amine.
| Compound Name | (E,5E)-N-ethenyl-5-(4-fluorophenyl)-5-(prop-2-enylhydrazinylidene)pent-2-en-2-amine |
|---|---|
| PubChem CID | 143488771 |
| Molecular Formula | C16H20FN3 |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | (E,5E)-N-ethenyl-5-(4-fluorophenyl)-5-(prop-2-enylhydrazinylidene)pent-2-en-2-amine |
| SMILES | C=CCN/N=C(\C/C=C(\C)NC=C)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H20FN3/c1-4-12-19-20-16(11-6-13(3)18-5-2)14-7-9-15(17)10-8-14/h4-10,18-19H,1-2,11-12H2,3H3/b13-6+,20-16+ |
| InChIKey | VMROVJLSIWTLSZ-KWXXRHKHSA-N |
| XLogP | 3.33 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|