C21H33F2NO — CID 143491217
2,2-difluorobutane;N-methyl-N-(3-methylidene-2-phenyloctyl)formamide (PubChem CID 143491217) has the molecular formula C21H33F2NO and a molecular weight of 353.50 g/mol. Its IUPAC name is 2,2-difluorobutane;N-methyl-N-(3-methylidene-2-phenyloctyl)formamide.
| Compound Name | 2,2-difluorobutane;N-methyl-N-(3-methylidene-2-phenyloctyl)formamide |
|---|---|
| PubChem CID | 143491217 |
| Molecular Formula | C21H33F2NO |
| Molecular Weight | 353.50 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | 2,2-difluorobutane;N-methyl-N-(3-methylidene-2-phenyloctyl)formamide |
| SMILES | C=C(CCCCC)C(CN(C)C=O)c1ccccc1.CCC(C)(F)F |
| InChI | InChI=1S/C17H25NO.C4H8F2/c1-4-5-7-10-15(2)17(13-18(3)14-19)16-11-8-6-9-12-16;1-3-4(2,5)6/h6,8-9,11-12,14,17H,2,4-5,7,10,13H2,1,3H3;3H2,1-2H3 |
| InChIKey | LWHKDWSAFMBSTL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.50 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|