C15H26N6 — CID 143492577
6-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-4-(cyclopropylmethyl)-1H-pyrimidine-2,4-diamine (PubChem CID 143492577) has the molecular formula C15H26N6 and a molecular weight of 290.41 g/mol. Its IUPAC name is 6-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-4-(cyclopropylmethyl)-1H-pyrimidine-2,4-diamine.
| Compound Name | 6-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-4-(cyclopropylmethyl)-1H-pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 143492577 |
| Molecular Formula | C15H26N6 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 6-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-4-(cyclopropylmethyl)-1H-pyrimidine-2,4-diamine |
| SMILES | NC1=NC(N)(CC2CC2)C=C(N2CC3CCCNC3C2)N1 |
| InChI | InChI=1S/C15H26N6/c16-14-19-13(7-15(17,20-14)6-10-3-4-10)21-8-11-2-1-5-18-12(11)9-21/h7,10-12,18H,1-6,8-9,17H2,(H3,16,19,20) |
| InChIKey | BLEUBVNRKIQYAE-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 91.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |