C23H36OS — CID 143495117
ethane;1-[3-[(2Z)-2-methylpenta-2,4-dienyl]phenyl]ethanone;methylsulfanylcyclohexane (PubChem CID 143495117) has the molecular formula C23H36OS and a molecular weight of 360.61 g/mol. Its IUPAC name is ethane;1-[3-[(2Z)-2-methylpenta-2,4-dienyl]phenyl]ethanone;methylsulfanylcyclohexane.
| Compound Name | ethane;1-[3-[(2Z)-2-methylpenta-2,4-dienyl]phenyl]ethanone;methylsulfanylcyclohexane |
|---|---|
| PubChem CID | 143495117 |
| Molecular Formula | C23H36OS |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | ethane;1-[3-[(2Z)-2-methylpenta-2,4-dienyl]phenyl]ethanone;methylsulfanylcyclohexane |
| SMILES | C=C/C=C(/C)Cc1cccc(C(C)=O)c1.CC.CSC1CCCCC1 |
| InChI | InChI=1S/C14H16O.C7H14S.C2H6/c1-4-6-11(2)9-13-7-5-8-14(10-13)12(3)15;1-8-7-5-3-2-4-6-7;1-2/h4-8,10H,1,9H2,2-3H3;7H,2-6H2,1H3;1-2H3/b11-6-;; |
| InChIKey | LYTYALWNDCIZEH-LEOXJOGCSA-N |
| XLogP | 7.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|