C6H10O2 — CID 143495144
5-methyl-3,6-dihydro-2H-pyran-3-ol (PubChem CID 143495144) has the molecular formula C6H10O2 and a molecular weight of 114.14 g/mol. Its IUPAC name is 5-methyl-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | 5-methyl-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 143495144 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | 5-methyl-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CC1=CC(O)COC1 |
| InChI | InChI=1S/C6H10O2/c1-5-2-6(7)4-8-3-5/h2,6-7H,3-4H2,1H3 |
| InChIKey | GVFFBLLFSQIMTP-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|