C30H37F3N4O3 — CID 143495706
3-(4-hydroxybutyl)-1-[1-[1-(pyridin-4-ylmethyl)piperidine-4-carbonyl]piperidin-4-yl]-5-(trifluoromethyl)-3H-indol-2-one (PubChem CID 143495706) has the molecular formula C30H37F3N4O3 and a molecular weight of 558.65 g/mol. Its IUPAC name is 3-(4-hydroxybutyl)-1-[1-[1-(pyridin-4-ylmethyl)piperidine-4-carbonyl]piperidin-4-yl]-5-(trifluoromethyl)-3H-indol-2-one.
| Compound Name | 3-(4-hydroxybutyl)-1-[1-[1-(pyridin-4-ylmethyl)piperidine-4-carbonyl]piperidin-4-yl]-5-(trifluoromethyl)-3H-indol-2-one |
|---|---|
| PubChem CID | 143495706 |
| Molecular Formula | C30H37F3N4O3 |
| Molecular Weight | 558.65 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | 3-(4-hydroxybutyl)-1-[1-[1-(pyridin-4-ylmethyl)piperidine-4-carbonyl]piperidin-4-yl]-5-(trifluoromethyl)-3H-indol-2-one |
| SMILES | O=C(C1CCN(Cc2ccncc2)CC1)N1CCC(N2C(=O)C(CCCCO)c3cc(C(F)(F)F)ccc32)CC1 |
| InChI | InChI=1S/C30H37F3N4O3/c31-30(32,33)23-4-5-27-26(19-23)25(3-1-2-18-38)29(40)37(27)24-10-16-36(17-11-24)28(39)22-8-14-35(15-9-22)20-21-6-12-34-13-7-21/h4-7,12-13,19,22,24-25,38H,1-3,8-11,14-18,20H2 |
| InChIKey | ZMJHWTXYSWJHCP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.65 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|