C22H26N6O3 — CID 143500404
N-[5-[4-[(1E)-2-methoxybuta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]-1H-pyrazol-4-yl]-5-(pyrrolidin-1-ylmethyl)furan-2-carboxamide (PubChem CID 143500404) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is N-[5-[4-[(1E)-2-methoxybuta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]-1H-pyrazol-4-yl]-5-(pyrrolidin-1-ylmethyl)furan-2-carboxamide.
| Compound Name | N-[5-[4-[(1E)-2-methoxybuta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]-1H-pyrazol-4-yl]-5-(pyrrolidin-1-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 143500404 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | N-[5-[4-[(1E)-2-methoxybuta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]-1H-pyrazol-4-yl]-5-(pyrrolidin-1-ylmethyl)furan-2-carboxamide |
| SMILES | C=C/C(=C\c1nc(-c2[nH]ncc2NC(=O)c2ccc(CN3CCCC3)o2)[nH]c1C)OC |
| InChI | InChI=1S/C22H26N6O3/c1-4-15(30-3)11-17-14(2)24-21(25-17)20-18(12-23-27-20)26-22(29)19-8-7-16(31-19)13-28-9-5-6-10-28/h4,7-8,11-12H,1,5-6,9-10,13H2,2-3H3,(H,23,27)(H,24,25)(H,26,29)/b15-11+ |
| InChIKey | BDGUXLFUVKSPLP-RVDMUPIBSA-N |
| XLogP | 3.72 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|