C24H25NO3 — CID 143501464
(5R)-5-cyclohepta-1,4-dien-1-yl-3-[[4-(phenoxymethyl)phenyl]methyl]-1,3-oxazolidin-2-one (PubChem CID 143501464) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is (5R)-5-cyclohepta-1,4-dien-1-yl-3-[[4-(phenoxymethyl)phenyl]methyl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-cyclohepta-1,4-dien-1-yl-3-[[4-(phenoxymethyl)phenyl]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 143501464 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (5R)-5-cyclohepta-1,4-dien-1-yl-3-[[4-(phenoxymethyl)phenyl]methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@H](C2=CCC=CCC2)CN1Cc1ccc(COc2ccccc2)cc1 |
| InChI | InChI=1S/C24H25NO3/c26-24-25(17-23(28-24)21-8-4-1-2-5-9-21)16-19-12-14-20(15-13-19)18-27-22-10-6-3-7-11-22/h1-3,6-8,10-15,23H,4-5,9,16-18H2/t23-/m0/s1 |
| InChIKey | DLVDDECIYJKPMJ-QHCPKHFHSA-N |
| XLogP | 5.25 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|