About 5-ethyl-7,8,10-triazatricyclo[5.3.0.02,4]deca-1(10),5,8-triene
5-ethyl-7,8,10-triazatricyclo[5.3.0.02,4]deca-1(10),5,8-triene (PubChem CID 143502317) has the molecular formula C9H11N3
and a molecular weight of 161.21 g/mol. Its IUPAC name is 5-ethyl-7,8,10-triazatricyclo[5.3.0.02,4]deca-1(10),5,8-triene.
Analyze 5-ethyl-7,8,10-triazatricyclo[5.3.0.02,4]deca-1(10),5,8-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-7,8,10-triazatricyclo[5.3.0.02,4]deca-1(10),5,8-triene?
The IUPAC name of 5-ethyl-7,8,10-triazatricyclo[5.3.0.02,4]deca-1(10),5,8-triene (CID 143502317) is 5-ethyl-7,8,10-triazatricyclo[5.3.0.02,4]deca-1(10),5,8-triene.
What is the SMILES notation for 5-ethyl-7,8,10-triazatricyclo[5.3.0.02,4]deca-1(10),5,8-triene?
The canonical SMILES for 5-ethyl-7,8,10-triazatricyclo[5.3.0.02,4]deca-1(10),5,8-triene is CCC1=Cn2ncnc2C2CC12.
What is the InChIKey of 5-ethyl-7,8,10-triazatricyclo[5.3.0.02,4]deca-1(10),5,8-triene?
The InChIKey is YRZYAPZYVCJBBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3/c1-2-6-4-12-9(10-5-11-12)8-3-7(6)8/h4-5,7-8H,2-3H2,1H3.
What are the key properties of 5-ethyl-7,8,10-triazatricyclo[5.3.0.02,4]deca-1(10),5,8-triene?
5-ethyl-7,8,10-triazatricyclo[5.3.0.02,4]deca-1(10),5,8-triene has a molecular weight of 161.21 g/mol, XLogP of 1.65, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-7,8,10-triazatricyclo[5.3.0.02,4]deca-1(10),5,8-triene is sourced from PubChem (CID 143502317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).