About 6-methyl-7,8-dihydro-[1,2,4]triazolo[1,5-a]pyridine
6-methyl-7,8-dihydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 143587982) has the molecular formula C7H9N3
and a molecular weight of 135.17 g/mol. Its IUPAC name is 6-methyl-7,8-dihydro-[1,2,4]triazolo[1,5-a]pyridine.
Analyze 6-methyl-7,8-dihydro-[1,2,4]triazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-7,8-dihydro-[1,2,4]triazolo[1,5-a]pyridine?
The IUPAC name of 6-methyl-7,8-dihydro-[1,2,4]triazolo[1,5-a]pyridine (CID 143587982) is 6-methyl-7,8-dihydro-[1,2,4]triazolo[1,5-a]pyridine.
What is the SMILES notation for 6-methyl-7,8-dihydro-[1,2,4]triazolo[1,5-a]pyridine?
The canonical SMILES for 6-methyl-7,8-dihydro-[1,2,4]triazolo[1,5-a]pyridine is CC1=Cn2ncnc2CC1.
What is the InChIKey of 6-methyl-7,8-dihydro-[1,2,4]triazolo[1,5-a]pyridine?
The InChIKey is GCFGUMNXYOROMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3/c1-6-2-3-7-8-5-9-10(7)4-6/h4-5H,2-3H2,1H3.
What are the key properties of 6-methyl-7,8-dihydro-[1,2,4]triazolo[1,5-a]pyridine?
6-methyl-7,8-dihydro-[1,2,4]triazolo[1,5-a]pyridine has a molecular weight of 135.17 g/mol, XLogP of 1.09, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-7,8-dihydro-[1,2,4]triazolo[1,5-a]pyridine is sourced from PubChem (CID 143587982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).