C23H24FN9O3 — CID 143502318
4-N-[2-amino-1-[4-[(Z)-N-aminocarbamohydrazonoyl]phenyl]-2-oxoethyl]-6-N-[(4-fluoro-3-methylphenyl)methyl]pyrimidine-4,6-dicarboxamide (PubChem CID 143502318) has the molecular formula C23H24FN9O3 and a molecular weight of 493.50 g/mol. Its IUPAC name is 4-N-[2-amino-1-[4-[(Z)-N-aminocarbamohydrazonoyl]phenyl]-2-oxoethyl]-6-N-[(4-fluoro-3-methylphenyl)methyl]pyrimidine-4,6-dicarboxamide.
| Compound Name | 4-N-[2-amino-1-[4-[(Z)-N-aminocarbamohydrazonoyl]phenyl]-2-oxoethyl]-6-N-[(4-fluoro-3-methylphenyl)methyl]pyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 143502318 |
| Molecular Formula | C23H24FN9O3 |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 4-N-[2-amino-1-[4-[(Z)-N-aminocarbamohydrazonoyl]phenyl]-2-oxoethyl]-6-N-[(4-fluoro-3-methylphenyl)methyl]pyrimidine-4,6-dicarboxamide |
| SMILES | Cc1cc(CNC(=O)c2cc(C(=O)NC(C(N)=O)c3ccc(/C(=N/N)NN)cc3)ncn2)ccc1F |
| InChI | InChI=1S/C23H24FN9O3/c1-12-8-13(2-7-16(12)24)10-28-22(35)17-9-18(30-11-29-17)23(36)31-19(20(25)34)14-3-5-15(6-4-14)21(32-26)33-27/h2-9,11,19H,10,26-27H2,1H3,(H2,25,34)(H,28,35)(H,31,36)(H,32,33) |
| InChIKey | IZRGYWNSNVDMTA-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 203.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|