C15H24FNO — CID 143503258
1-butyl-4-(4-fluorocyclohexa-1,3-dien-1-yl)oxypiperidine (PubChem CID 143503258) has the molecular formula C15H24FNO and a molecular weight of 253.36 g/mol. Its IUPAC name is 1-butyl-4-(4-fluorocyclohexa-1,3-dien-1-yl)oxypiperidine.
| Compound Name | 1-butyl-4-(4-fluorocyclohexa-1,3-dien-1-yl)oxypiperidine |
|---|---|
| PubChem CID | 143503258 |
| Molecular Formula | C15H24FNO |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 1-butyl-4-(4-fluorocyclohexa-1,3-dien-1-yl)oxypiperidine |
| SMILES | CCCCN1CCC(OC2=CC=C(F)CC2)CC1 |
| InChI | InChI=1S/C15H24FNO/c1-2-3-10-17-11-8-15(9-12-17)18-14-6-4-13(16)5-7-14/h4,6,15H,2-3,5,7-12H2,1H3 |
| InChIKey | UNBWYQGEQYOWMR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |