C13H21NO — CID 123679431
1-(4-ethoxycyclohexa-1,3-dien-1-yl)piperidine (PubChem CID 123679431) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 1-(4-ethoxycyclohexa-1,3-dien-1-yl)piperidine.
| Compound Name | 1-(4-ethoxycyclohexa-1,3-dien-1-yl)piperidine |
|---|---|
| PubChem CID | 123679431 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 1-(4-ethoxycyclohexa-1,3-dien-1-yl)piperidine |
| SMILES | CCOC1=CC=C(N2CCCCC2)CC1 |
| InChI | InChI=1S/C13H21NO/c1-2-15-13-8-6-12(7-9-13)14-10-4-3-5-11-14/h6,8H,2-5,7,9-11H2,1H3 |
| InChIKey | LUHMLOHNVSAFJU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |