About ethane;(3Z)-N-ethyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine
ethane;(3Z)-N-ethyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine (PubChem CID 143503839) has the molecular formula C14H29NO
and a molecular weight of 227.39 g/mol. Its IUPAC name is ethane;(3Z)-N-ethyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine.
Molecular Properties
| Compound Name | ethane;(3Z)-N-ethyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine |
| PubChem CID | 143503839 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | ethane;(3Z)-N-ethyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine |
| SMILES | C=C(/C=C\C(=C)N(C)CC)OC.CC.CC |
| InChI | InChI=1S/C10H17NO.2C2H6/c1-6-11(4)9(2)7-8-10(3)12-5;2*1-2/h7-8H,2-3,6H2,1,4-5H3;2*1-2H3/b8-7-;; |
| InChIKey | BZOGAOPUEKSCSP-OTMFCZTRSA-N |
| XLogP | 4.22 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(3Z)-N-ethyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3Z)-N-ethyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine?
The IUPAC name of ethane;(3Z)-N-ethyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine (CID 143503839) is ethane;(3Z)-N-ethyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine.
What is the SMILES notation for ethane;(3Z)-N-ethyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine?
The canonical SMILES for ethane;(3Z)-N-ethyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine is C=C(/C=C\C(=C)N(C)CC)OC.CC.CC.
What is the InChIKey of ethane;(3Z)-N-ethyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine?
The InChIKey is BZOGAOPUEKSCSP-OTMFCZTRSA-N. The full InChI is InChI=1S/C10H17NO.2C2H6/c1-6-11(4)9(2)7-8-10(3)12-5;2*1-2/h7-8H,2-3,6H2,1,4-5H3;2*1-2H3/b8-7-;;.
What are the key properties of ethane;(3Z)-N-ethyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine?
ethane;(3Z)-N-ethyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine has a molecular weight of 227.39 g/mol, XLogP of 4.22, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3Z)-N-ethyl-5-methoxy-N-methylhexa-1,3,5-trien-2-amine is sourced from PubChem (CID 143503839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).