C11H19NO — CID 138633519
(3Z,5E)-5-methoxy-N,N-dimethylocta-1,3,5-trien-2-amine (PubChem CID 138633519) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (3Z,5E)-5-methoxy-N,N-dimethylocta-1,3,5-trien-2-amine.
| Compound Name | (3Z,5E)-5-methoxy-N,N-dimethylocta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 138633519 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (3Z,5E)-5-methoxy-N,N-dimethylocta-1,3,5-trien-2-amine |
| SMILES | C=C(/C=C\C(=C/CC)OC)N(C)C |
| InChI | InChI=1S/C11H19NO/c1-6-7-11(13-5)9-8-10(2)12(3)4/h7-9H,2,6H2,1,3-5H3/b9-8-,11-7+ |
| InChIKey | JZOINSVVFBFXOZ-NVKZJLNYSA-N |
| XLogP | 2.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|