C9H17NO — CID 138633495
(2E,4E)-4-methoxy-N,N-dimethylhexa-2,4-dien-2-amine (PubChem CID 138633495) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is (2E,4E)-4-methoxy-N,N-dimethylhexa-2,4-dien-2-amine.
| Compound Name | (2E,4E)-4-methoxy-N,N-dimethylhexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 138633495 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | (2E,4E)-4-methoxy-N,N-dimethylhexa-2,4-dien-2-amine |
| SMILES | C/C=C(\C=C(/C)N(C)C)OC |
| InChI | InChI=1S/C9H17NO/c1-6-9(11-5)7-8(2)10(3)4/h6-7H,1-5H3/b8-7+,9-6+ |
| InChIKey | UNVQCHXRKSILDF-KHHFIZIMSA-N |
| XLogP | 2.00 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|