C21H38N2O4 — CID 143504577
benzyl N-(4-methylpentan-2-yl)carbamate;butane;N-(2-hydroxyethyl)formamide (PubChem CID 143504577) has the molecular formula C21H38N2O4 and a molecular weight of 382.55 g/mol. Its IUPAC name is benzyl N-(4-methylpentan-2-yl)carbamate;butane;N-(2-hydroxyethyl)formamide.
| Compound Name | benzyl N-(4-methylpentan-2-yl)carbamate;butane;N-(2-hydroxyethyl)formamide |
|---|---|
| PubChem CID | 143504577 |
| Molecular Formula | C21H38N2O4 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.28 |
| IUPAC Name | benzyl N-(4-methylpentan-2-yl)carbamate;butane;N-(2-hydroxyethyl)formamide |
| SMILES | CC(C)CC(C)NC(=O)OCc1ccccc1.CCCC.O=CNCCO |
| InChI | InChI=1S/C14H21NO2.C4H10.C3H7NO2/c1-11(2)9-12(3)15-14(16)17-10-13-7-5-4-6-8-13;1-3-4-2;5-2-1-4-3-6/h4-8,11-12H,9-10H2,1-3H3,(H,15,16);3-4H2,1-2H3;3,5H,1-2H2,(H,4,6) |
| InChIKey | YJCDLNOYHZGNER-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|