C16H16N4O2S — CID 143505069
3-(aminomethylsulfanyl)-4-(4-phenylmethoxyphenyl)-1H-1,2,4-triazol-5-one (PubChem CID 143505069) has the molecular formula C16H16N4O2S and a molecular weight of 328.40 g/mol. Its IUPAC name is 3-(aminomethylsulfanyl)-4-(4-phenylmethoxyphenyl)-1H-1,2,4-triazol-5-one.
| Compound Name | 3-(aminomethylsulfanyl)-4-(4-phenylmethoxyphenyl)-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 143505069 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 3-(aminomethylsulfanyl)-4-(4-phenylmethoxyphenyl)-1H-1,2,4-triazol-5-one |
| SMILES | NCSc1n[nH]c(=O)n1-c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H16N4O2S/c17-11-23-16-19-18-15(21)20(16)13-6-8-14(9-7-13)22-10-12-4-2-1-3-5-12/h1-9H,10-11,17H2,(H,18,21) |
| InChIKey | BMFAMZSYPWHHNE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|