C17H14N2O3 — CID 22425284
4-(4-phenylmethoxyphenyl)-1H-pyrazine-2,3-dione (PubChem CID 22425284) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 4-(4-phenylmethoxyphenyl)-1H-pyrazine-2,3-dione.
| Compound Name | 4-(4-phenylmethoxyphenyl)-1H-pyrazine-2,3-dione |
|---|---|
| PubChem CID | 22425284 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-(4-phenylmethoxyphenyl)-1H-pyrazine-2,3-dione |
| SMILES | O=c1[nH]ccn(-c2ccc(OCc3ccccc3)cc2)c1=O |
| InChI | InChI=1S/C17H14N2O3/c20-16-17(21)19(11-10-18-16)14-6-8-15(9-7-14)22-12-13-4-2-1-3-5-13/h1-11H,12H2,(H,18,20) |
| InChIKey | XAWSGCKOMGZUCQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|