C11H14N2O2 — CID 143510283
5-[(2Z,4Z)-4-methylhepta-2,4,6-trienyl]imidazolidine-2,4-dione (PubChem CID 143510283) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 5-[(2Z,4Z)-4-methylhepta-2,4,6-trienyl]imidazolidine-2,4-dione.
| Compound Name | 5-[(2Z,4Z)-4-methylhepta-2,4,6-trienyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143510283 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 5-[(2Z,4Z)-4-methylhepta-2,4,6-trienyl]imidazolidine-2,4-dione |
| SMILES | C=C/C=C(C)\C=C/CC1NC(=O)NC1=O |
| InChI | InChI=1S/C11H14N2O2/c1-3-5-8(2)6-4-7-9-10(14)13-11(15)12-9/h3-6,9H,1,7H2,2H3,(H2,12,13,14,15)/b6-4-,8-5- |
| InChIKey | MTMMYXYNTZNVND-VXWIUBPCSA-N |
| XLogP | 1.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|