C29H38N4O5 — CID 143510353
ethane;(5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[(3E,5E)-6-[(E)-1-(propylideneamino)but-1-en-2-yl]oxyhepta-1,3,5-trien-3-yl]imidazolidine-2,4-dione (PubChem CID 143510353) has the molecular formula C29H38N4O5 and a molecular weight of 522.65 g/mol. Its IUPAC name is ethane;(5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[(3E,5E)-6-[(E)-1-(propylideneamino)but-1-en-2-yl]oxyhepta-1,3,5-trien-3-yl]imidazolidine-2,4-dione.
| Compound Name | ethane;(5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[(3E,5E)-6-[(E)-1-(propylideneamino)but-1-en-2-yl]oxyhepta-1,3,5-trien-3-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143510353 |
| Molecular Formula | C29H38N4O5 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | ethane;(5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[(3E,5E)-6-[(E)-1-(propylideneamino)but-1-en-2-yl]oxyhepta-1,3,5-trien-3-yl]imidazolidine-2,4-dione |
| SMILES | C=C/C(=C\C=C(/C)O/C(=C/N=C/CC)CC)[C@]1(CN2Cc3ccc(OC)cc3C2=O)NC(=O)NC1=O.CC |
| InChI | InChI=1S/C27H32N4O5.C2H6/c1-6-13-28-15-21(8-3)36-18(4)9-11-20(7-2)27(25(33)29-26(34)30-27)17-31-16-19-10-12-22(35-5)14-23(19)24(31)32;1-2/h7,9-15H,2,6,8,16-17H2,1,3-5H3,(H2,29,30,33,34);1-2H3/b18-9+,20-11+,21-15+,28-13+;/t27-;/m0./s1 |
| InChIKey | SBKMMQJWQNATSU-GVYNIMHESA-N |
| XLogP | 5.02 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|