C21H28N4O5 — CID 126748370
2-[4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-methyl-N-pentylacetamide (PubChem CID 126748370) has the molecular formula C21H28N4O5 and a molecular weight of 416.48 g/mol. Its IUPAC name is 2-[4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-methyl-N-pentylacetamide.
| Compound Name | 2-[4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-methyl-N-pentylacetamide |
|---|---|
| PubChem CID | 126748370 |
| Molecular Formula | C21H28N4O5 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 2-[4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-methyl-N-pentylacetamide |
| SMILES | CCCCCN(C)C(=O)CC1(CN2Cc3ccc(OC)cc3C2=O)NC(=O)NC1=O |
| InChI | InChI=1S/C21H28N4O5/c1-4-5-6-9-24(2)17(26)11-21(19(28)22-20(29)23-21)13-25-12-14-7-8-15(30-3)10-16(14)18(25)27/h7-8,10H,4-6,9,11-13H2,1-3H3,(H2,22,23,28,29) |
| InChIKey | NBKOTDCAXZTNTP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|