C30H31N5O6 — CID 91395948
5-[[4-[2-[4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]phenyl]methyl]-5-pentylimidazolidine-2,4-dione (PubChem CID 91395948) has the molecular formula C30H31N5O6 and a molecular weight of 557.61 g/mol. Its IUPAC name is 5-[[4-[2-[4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]phenyl]methyl]-5-pentylimidazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-[4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]phenyl]methyl]-5-pentylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91395948 |
| Molecular Formula | C30H31N5O6 |
| Molecular Weight | 557.61 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | 5-[[4-[2-[4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]phenyl]methyl]-5-pentylimidazolidine-2,4-dione |
| SMILES | CCCCCC1(Cc2ccc(C#CC3(CN4Cc5ccc(OC)cc5C4=O)NC(=O)NC3=O)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C30H31N5O6/c1-3-4-5-13-29(25(37)31-27(39)33-29)16-20-8-6-19(7-9-20)12-14-30(26(38)32-28(40)34-30)18-35-17-21-10-11-22(41-2)15-23(21)24(35)36/h6-11,15H,3-5,13,16-18H2,1-2H3,(H2,31,33,37,39)(H2,32,34,38,40) |
| InChIKey | KXYLYQUFEKPAAN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 145.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.61 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|